C20H26N6 — CID 11667459
2-[3-[4-[(dimethylamino)methyl]cyclohexyl]prop-1-ynyl]-9-prop-2-ynylpurin-6-amine (PubChem CID 11667459) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[3-[4-[(dimethylamino)methyl]cyclohexyl]prop-1-ynyl]-9-prop-2-ynylpurin-6-amine.
| Compound Name | 2-[3-[4-[(dimethylamino)methyl]cyclohexyl]prop-1-ynyl]-9-prop-2-ynylpurin-6-amine |
|---|---|
| PubChem CID | 11667459 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-[3-[4-[(dimethylamino)methyl]cyclohexyl]prop-1-ynyl]-9-prop-2-ynylpurin-6-amine |
| SMILES | C#CCn1cnc2c(N)nc(C#CCC3CCC(CN(C)C)CC3)nc21 |
| InChI | InChI=1S/C20H26N6/c1-4-12-26-14-22-18-19(21)23-17(24-20(18)26)7-5-6-15-8-10-16(11-9-15)13-25(2)3/h1,14-16H,6,8-13H2,2-3H3,(H2,21,23,24) |
| InChIKey | OBAPEEDDWVNRKP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|