C21H30N6O5 — CID 68658475
(2S)-2-[[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide (PubChem CID 68658475) has the molecular formula C21H30N6O5 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S)-2-[[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide.
| Compound Name | (2S)-2-[[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 68658475 |
| Molecular Formula | C21H30N6O5 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (2S)-2-[[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]methoxy]-N-ethyl-3,4-dihydroxybutanamide |
| SMILES | CCNC(=O)[C@@H](OCn1cnc2c(N)nc(C#C[C@]3(O)CCC[C@@H](C)C3)nc21)C(O)CO |
| InChI | InChI=1S/C21H30N6O5/c1-3-23-20(30)17(14(29)10-28)32-12-27-11-24-16-18(22)25-15(26-19(16)27)6-8-21(31)7-4-5-13(2)9-21/h11,13-14,17,28-29,31H,3-5,7,9-10,12H2,1-2H3,(H,23,30)(H2,22,25,26)/t13-,14?,17+,21-/m1/s1 |
| InChIKey | CAOYGBXOQYPDHA-LPOXIVASSA-N |
| XLogP | -0.47 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|