C20H27N5OS — CID 158634962
sulfane;trans-(1S,3R)-1-[2-[6-[[(2S)-butan-2-yl]amino]-9-ethynylpurin-2-yl]ethynyl]-3-methylcyclohexan-1-ol (PubChem CID 158634962) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is sulfane;trans-(1S,3R)-1-[2-[6-[[(2S)-butan-2-yl]amino]-9-ethynylpurin-2-yl]ethynyl]-3-methylcyclohexan-1-ol.
| Compound Name | sulfane;trans-(1S,3R)-1-[2-[6-[[(2S)-butan-2-yl]amino]-9-ethynylpurin-2-yl]ethynyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 158634962 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | sulfane;trans-(1S,3R)-1-[2-[6-[[(2S)-butan-2-yl]amino]-9-ethynylpurin-2-yl]ethynyl]-3-methylcyclohexan-1-ol |
| SMILES | C#Cn1cnc2c(N[C@@H](C)CC)nc(C#C[C@]3(O)CCC[C@@H](C)C3)nc21.S |
| InChI | InChI=1S/C20H25N5O.H2S/c1-5-15(4)22-18-17-19(25(6-2)13-21-17)24-16(23-18)9-11-20(26)10-7-8-14(3)12-20;/h2,13-15,26H,5,7-8,10,12H2,1,3-4H3,(H,22,23,24);1H2/t14-,15+,20-;/m1./s1 |
| InChIKey | HZQSJWBJJBLUGQ-FFICIRFRSA-N |
| XLogP | 2.88 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|