C24H25N5O2 — CID 59763808
trans-(1S,3R)-1-[2-[9-ethynyl-6-[(3-methoxyphenyl)methylamino]purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol (PubChem CID 59763808) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is trans-(1S,3R)-1-[2-[9-ethynyl-6-[(3-methoxyphenyl)methylamino]purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol.
| Compound Name | trans-(1S,3R)-1-[2-[9-ethynyl-6-[(3-methoxyphenyl)methylamino]purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 59763808 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | trans-(1S,3R)-1-[2-[9-ethynyl-6-[(3-methoxyphenyl)methylamino]purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol |
| SMILES | C#Cn1cnc2c(NCc3cccc(OC)c3)nc(C#C[C@]3(O)CCC[C@@H](C)C3)nc21 |
| InChI | InChI=1S/C24H25N5O2/c1-4-29-16-26-21-22(25-15-18-8-5-9-19(13-18)31-3)27-20(28-23(21)29)10-12-24(30)11-6-7-17(2)14-24/h1,5,8-9,13,16-17,30H,6-7,11,14-15H2,2-3H3,(H,25,27,28)/t17-,24-/m1/s1 |
| InChIKey | KUDZGSLOKNLBHE-MZNJEOGPSA-N |
| XLogP | 3.18 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|