C21H24N6O — CID 89327712
trans-(1S,3R)-3-methyl-1-[9-prop-2-ynyl-6-(pyridin-2-ylmethylamino)purin-2-yl]cyclohexan-1-ol (PubChem CID 89327712) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is trans-(1S,3R)-3-methyl-1-[9-prop-2-ynyl-6-(pyridin-2-ylmethylamino)purin-2-yl]cyclohexan-1-ol.
| Compound Name | trans-(1S,3R)-3-methyl-1-[9-prop-2-ynyl-6-(pyridin-2-ylmethylamino)purin-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 89327712 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | trans-(1S,3R)-3-methyl-1-[9-prop-2-ynyl-6-(pyridin-2-ylmethylamino)purin-2-yl]cyclohexan-1-ol |
| SMILES | C#CCn1cnc2c(NCc3ccccn3)nc([C@]3(O)CCC[C@@H](C)C3)nc21 |
| InChI | InChI=1S/C21H24N6O/c1-3-11-27-14-24-17-18(23-13-16-8-4-5-10-22-16)25-20(26-19(17)27)21(28)9-6-7-15(2)12-21/h1,4-5,8,10,14-15,28H,6-7,9,11-13H2,2H3,(H,23,25,26)/t15-,21+/m1/s1 |
| InChIKey | XJRJFYABMUNXFQ-VFNWGFHPSA-N |
| XLogP | 2.86 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|