C26H33N5 — CID 143121119
9-benzyl-2-[2-[(3R)-3-methylcyclohexyl]ethynyl]-N-pentan-3-ylpurin-6-amine (PubChem CID 143121119) has the molecular formula C26H33N5 and a molecular weight of 415.59 g/mol. Its IUPAC name is 9-benzyl-2-[2-[(3R)-3-methylcyclohexyl]ethynyl]-N-pentan-3-ylpurin-6-amine.
| Compound Name | 9-benzyl-2-[2-[(3R)-3-methylcyclohexyl]ethynyl]-N-pentan-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 143121119 |
| Molecular Formula | C26H33N5 |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 9-benzyl-2-[2-[(3R)-3-methylcyclohexyl]ethynyl]-N-pentan-3-ylpurin-6-amine |
| SMILES | CCC(CC)Nc1nc(C#CC2CCC[C@@H](C)C2)nc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C26H33N5/c1-4-22(5-2)28-25-24-26(31(18-27-24)17-21-11-7-6-8-12-21)30-23(29-25)15-14-20-13-9-10-19(3)16-20/h6-8,11-12,18-20,22H,4-5,9-10,13,16-17H2,1-3H3,(H,28,29,30)/t19-,20?/m1/s1 |
| InChIKey | KOSUGRZFXWVUMR-FIWHBWSRSA-N |
| XLogP | 5.65 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|