C19H24ClN5 — CID 10882854
(9-benzyl-2-cyclohexylpurin-6-yl)-methylazanium chloride (PubChem CID 10882854) has the molecular formula C19H24ClN5 and a molecular weight of 357.89 g/mol. Its IUPAC name is (9-benzyl-2-cyclohexylpurin-6-yl)-methylazanium chloride.
| Compound Name | (9-benzyl-2-cyclohexylpurin-6-yl)-methylazanium chloride |
|---|---|
| PubChem CID | 10882854 |
| Molecular Formula | C19H24ClN5 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (9-benzyl-2-cyclohexylpurin-6-yl)-methylazanium chloride |
| SMILES | C[NH2+]c1nc(C2CCCCC2)nc2c1ncn2Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H23N5.ClH/c1-20-18-16-19(23-17(22-18)15-10-6-3-7-11-15)24(13-21-16)12-14-8-4-2-5-9-14;/h2,4-5,8-9,13,15H,3,6-7,10-12H2,1H3,(H,20,22,23);1H |
| InChIKey | NTVWBUBGJXQIED-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |