C26H33N5O — CID 11561054
trans-(1S,3R)-1-[2-[9-benzyl-6-(pentan-3-ylamino)purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol (PubChem CID 11561054) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is trans-(1S,3R)-1-[2-[9-benzyl-6-(pentan-3-ylamino)purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol.
| Compound Name | trans-(1S,3R)-1-[2-[9-benzyl-6-(pentan-3-ylamino)purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11561054 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | trans-(1S,3R)-1-[2-[9-benzyl-6-(pentan-3-ylamino)purin-2-yl]ethynyl]-3-methylcyclohexan-1-ol |
| SMILES | CCC(CC)Nc1nc(C#C[C@]2(O)CCC[C@@H](C)C2)nc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C26H33N5O/c1-4-21(5-2)28-24-23-25(31(18-27-23)17-20-11-7-6-8-12-20)30-22(29-24)13-15-26(32)14-9-10-19(3)16-26/h6-8,11-12,18-19,21,32H,4-5,9-10,14,16-17H2,1-3H3,(H,28,29,30)/t19-,26-/m1/s1 |
| InChIKey | YWXVOKFCMGXUME-NIYFSFCBSA-N |
| XLogP | 4.77 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|