C23H35N5O — CID 21097931
trans-(1S,3R)-3-methyl-1-[2-[9-(2-methylpropyl)-6-(pentan-3-ylamino)purin-2-yl]ethynyl]cyclohexan-1-ol (PubChem CID 21097931) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is trans-(1S,3R)-3-methyl-1-[2-[9-(2-methylpropyl)-6-(pentan-3-ylamino)purin-2-yl]ethynyl]cyclohexan-1-ol.
| Compound Name | trans-(1S,3R)-3-methyl-1-[2-[9-(2-methylpropyl)-6-(pentan-3-ylamino)purin-2-yl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 21097931 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | trans-(1S,3R)-3-methyl-1-[2-[9-(2-methylpropyl)-6-(pentan-3-ylamino)purin-2-yl]ethynyl]cyclohexan-1-ol |
| SMILES | CCC(CC)Nc1nc(C#C[C@]2(O)CCC[C@@H](C)C2)nc2c1ncn2CC(C)C |
| InChI | InChI=1S/C23H35N5O/c1-6-18(7-2)25-21-20-22(28(15-24-20)14-16(3)4)27-19(26-21)10-12-23(29)11-8-9-17(5)13-23/h15-18,29H,6-9,11,13-14H2,1-5H3,(H,25,26,27)/t17-,23-/m1/s1 |
| InChIKey | MADOPIKPFCMZNI-UZUQRXQVSA-N |
| XLogP | 4.38 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|