C17H21N5O — CID 11404155
trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynyl-7,8-dihydropurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol (PubChem CID 11404155) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynyl-7,8-dihydropurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol.
| Compound Name | trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynyl-7,8-dihydropurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11404155 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynyl-7,8-dihydropurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol |
| SMILES | C#CCN1CNc2c(N)nc(C#C[C@]3(O)CCC[C@@H](C)C3)nc21 |
| InChI | InChI=1S/C17H21N5O/c1-3-9-22-11-19-14-15(18)20-13(21-16(14)22)6-8-17(23)7-4-5-12(2)10-17/h1,12,19,23H,4-5,7,9-11H2,2H3,(H2,18,20,21)/t12-,17-/m1/s1 |
| InChIKey | VNTGJUAEVXNODR-SJKOYZFVSA-N |
| XLogP | 1.17 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|