C18H32N6O2 — CID 67367458
2-[3-[2-(6-amino-2-butoxy-7,8-dihydropurin-9-yl)ethyl]piperidin-1-yl]ethanol (PubChem CID 67367458) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[3-[2-(6-amino-2-butoxy-7,8-dihydropurin-9-yl)ethyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[3-[2-(6-amino-2-butoxy-7,8-dihydropurin-9-yl)ethyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 67367458 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 2-[3-[2-(6-amino-2-butoxy-7,8-dihydropurin-9-yl)ethyl]piperidin-1-yl]ethanol |
| SMILES | CCCCOc1nc(N)c2c(n1)N(CCC1CCCN(CCO)C1)CN2 |
| InChI | InChI=1S/C18H32N6O2/c1-2-3-11-26-18-21-16(19)15-17(22-18)24(13-20-15)8-6-14-5-4-7-23(12-14)9-10-25/h14,20,25H,2-13H2,1H3,(H2,19,21,22) |
| InChIKey | YFSRVGHMWWWGJJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|