C12H26O2S — CID 89252168
3-ethylsulfonyl-2,2,5,5-tetramethylhexane (PubChem CID 89252168) has the molecular formula C12H26O2S and a molecular weight of 234.40 g/mol. Its IUPAC name is 3-ethylsulfonyl-2,2,5,5-tetramethylhexane.
| Compound Name | 3-ethylsulfonyl-2,2,5,5-tetramethylhexane |
|---|---|
| PubChem CID | 89252168 |
| Molecular Formula | C12H26O2S |
| Molecular Weight | 234.40 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-ethylsulfonyl-2,2,5,5-tetramethylhexane |
| SMILES | CCS(=O)(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2S/c1-8-15(13,14)10(12(5,6)7)9-11(2,3)4/h10H,8-9H2,1-7H3 |
| InChIKey | URELNEUSKKIDQR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |