C10H17F3NO5P — CID 89253544
phosphoric acid;4-(2,4,5-trifluorophenyl)butan-2-amine;hydrate (PubChem CID 89253544) has the molecular formula C10H17F3NO5P and a molecular weight of 319.22 g/mol. Its IUPAC name is phosphoric acid;4-(2,4,5-trifluorophenyl)butan-2-amine;hydrate.
| Compound Name | phosphoric acid;4-(2,4,5-trifluorophenyl)butan-2-amine;hydrate |
|---|---|
| PubChem CID | 89253544 |
| Molecular Formula | C10H17F3NO5P |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | phosphoric acid;4-(2,4,5-trifluorophenyl)butan-2-amine;hydrate |
| SMILES | CC(N)CCc1cc(F)c(F)cc1F.O.O=P(O)(O)O |
| InChI | InChI=1S/C10H12F3N.H3O4P.H2O/c1-6(14)2-3-7-4-9(12)10(13)5-8(7)11;1-5(2,3)4;/h4-6H,2-3,14H2,1H3;(H3,1,2,3,4);1H2 |
| InChIKey | CSTKZIUAPLODIU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|