C30H32O8 — CID 89257735
[4,5-diacetyloxy-6-anthracen-2-yloxy-3-(2-methylprop-2-enyl)oxan-2-yl]methyl acetate (PubChem CID 89257735) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-anthracen-2-yloxy-3-(2-methylprop-2-enyl)oxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-anthracen-2-yloxy-3-(2-methylprop-2-enyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89257735 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [4,5-diacetyloxy-6-anthracen-2-yloxy-3-(2-methylprop-2-enyl)oxan-2-yl]methyl acetate |
| SMILES | C=C(C)CC1C(COC(C)=O)OC(Oc2ccc3cc4ccccc4cc3c2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C30H32O8/c1-17(2)12-26-27(16-34-18(3)31)38-30(29(36-20(5)33)28(26)35-19(4)32)37-25-11-10-23-13-21-8-6-7-9-22(21)14-24(23)15-25/h6-11,13-15,26-30H,1,12,16H2,2-5H3 |
| InChIKey | BPFUYUKREVSHGF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|