About 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine
5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 89260422) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine.
Analyze 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine (CID 89260422) is 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine is CCC1C=C2CCNC2=NC1.
What is the InChIKey of 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is YWYUISPKSSNTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-7-5-8-3-4-10-9(8)11-6-7/h5,7H,2-4,6H2,1H3,(H,10,11).
What are the key properties of 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine?
5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 150.22 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 89260422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).