C6H8N2 — CID 90889111
1,2,3,5-tetrahydropyrrolo[2,3-b]pyrrole (PubChem CID 90889111) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is 1,2,3,5-tetrahydropyrrolo[2,3-b]pyrrole.
| Compound Name | 1,2,3,5-tetrahydropyrrolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 90889111 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 1,2,3,5-tetrahydropyrrolo[2,3-b]pyrrole |
| SMILES | C1=C2CCNC2=NC1 |
| InChI | InChI=1S/C6H8N2/c1-3-7-6-5(1)2-4-8-6/h1H,2-4H2,(H,7,8) |
| InChIKey | MHYUOZHRQHWPMH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |