C13H16BrClO3 — CID 89264146
2-[3-(bromomethyl)-4-chloro-5-methylphenoxy]-3-methylbutanoic acid (PubChem CID 89264146) has the molecular formula C13H16BrClO3 and a molecular weight of 335.63 g/mol. Its IUPAC name is 2-[3-(bromomethyl)-4-chloro-5-methylphenoxy]-3-methylbutanoic acid.
| Compound Name | 2-[3-(bromomethyl)-4-chloro-5-methylphenoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 89264146 |
| Molecular Formula | C13H16BrClO3 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-[3-(bromomethyl)-4-chloro-5-methylphenoxy]-3-methylbutanoic acid |
| SMILES | Cc1cc(OC(C(=O)O)C(C)C)cc(CBr)c1Cl |
| InChI | InChI=1S/C13H16BrClO3/c1-7(2)12(13(16)17)18-10-4-8(3)11(15)9(5-10)6-14/h4-5,7,12H,6H2,1-3H3,(H,16,17) |
| InChIKey | AGYSIMZULDPQOW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|