C24H17NO4 — CID 8926526
9H-fluoren-9-yl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926526) has the molecular formula C24H17NO4 and a molecular weight of 383.40 g/mol. Its IUPAC name is 9H-fluoren-9-yl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 9H-fluoren-9-yl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926526 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 9H-fluoren-9-yl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OC1c2ccccc2-c2ccccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H17NO4/c1-14(25-22(26)19-12-6-7-13-20(19)23(25)27)24(28)29-21-17-10-4-2-8-15(17)16-9-3-5-11-18(16)21/h2-14,21H,1H3/t14-/m0/s1 |
| InChIKey | UJKOINYEVUGQQP-AWEZNQCLSA-N |
| XLogP | 3.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|