C25H25Cl2IN4O3 — CID 89270258
tert-butyl N-[6-chloro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]-N-[(4-chloro-3-iodocyclohexa-1,5-dien-1-yl)methyl]carbamate (PubChem CID 89270258) has the molecular formula C25H25Cl2IN4O3 and a molecular weight of 627.31 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]-N-[(4-chloro-3-iodocyclohexa-1,5-dien-1-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]-N-[(4-chloro-3-iodocyclohexa-1,5-dien-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 89270258 |
| Molecular Formula | C25H25Cl2IN4O3 |
| Molecular Weight | 627.31 g/mol |
| Exact Mass | 626.03 |
| IUPAC Name | tert-butyl N-[6-chloro-5-[hydroxy(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-2-pyridinyl]-N-[(4-chloro-3-iodocyclohexa-1,5-dien-1-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC(I)C(Cl)C=C1)c1ccc(C(O)c2c[nH]c3ncccc23)c(Cl)n1 |
| InChI | InChI=1S/C25H25Cl2IN4O3/c1-25(2,3)35-24(34)32(13-14-6-8-18(26)19(28)11-14)20-9-7-16(22(27)31-20)21(33)17-12-30-23-15(17)5-4-10-29-23/h4-12,18-19,21,33H,13H2,1-3H3,(H,29,30) |
| InChIKey | ZTMZCISOLBWXID-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|