C12H22N4 — CID 89270685
(2S)-3-[4-(aminomethyl)-5-iminopent-1-en-2-yl]-N-methyl-1,2,3,4-tetrahydropyridin-2-amine (PubChem CID 89270685) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is (2S)-3-[4-(aminomethyl)-5-iminopent-1-en-2-yl]-N-methyl-1,2,3,4-tetrahydropyridin-2-amine.
| Compound Name | (2S)-3-[4-(aminomethyl)-5-iminopent-1-en-2-yl]-N-methyl-1,2,3,4-tetrahydropyridin-2-amine |
|---|---|
| PubChem CID | 89270685 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (2S)-3-[4-(aminomethyl)-5-iminopent-1-en-2-yl]-N-methyl-1,2,3,4-tetrahydropyridin-2-amine |
| SMILES | [H]/N=C/C(CN)CC(=C)C1CC=CN[C@@H]1NC |
| InChI | InChI=1S/C12H22N4/c1-9(6-10(7-13)8-14)11-4-3-5-16-12(11)15-2/h3,5,7,10-13,15-16H,1,4,6,8,14H2,2H3/b13-7+/t10?,11?,12-/m0/s1 |
| InChIKey | GRYAWHXQEQDFIV-FFZBDPDRSA-N |
| XLogP | 0.83 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|