C11H20N2 — CID 163825885
1-(3,4-dihydropyridin-3-yl)-N-methylpentan-1-amine (PubChem CID 163825885) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-(3,4-dihydropyridin-3-yl)-N-methylpentan-1-amine.
| Compound Name | 1-(3,4-dihydropyridin-3-yl)-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 163825885 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-(3,4-dihydropyridin-3-yl)-N-methylpentan-1-amine |
| SMILES | CCCCC(NC)C1C=NC=CC1 |
| InChI | InChI=1S/C11H20N2/c1-3-4-7-11(12-2)10-6-5-8-13-9-10/h5,8-12H,3-4,6-7H2,1-2H3 |
| InChIKey | NZLVNJLRQBGWBW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |