C18H33N3O3 — CID 89273251
(E,4S)-4-[(2-formamidoacetyl)-methylamino]-N-hexyl-2,5-dimethylhex-2-enamide (PubChem CID 89273251) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is (E,4S)-4-[(2-formamidoacetyl)-methylamino]-N-hexyl-2,5-dimethylhex-2-enamide.
| Compound Name | (E,4S)-4-[(2-formamidoacetyl)-methylamino]-N-hexyl-2,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 89273251 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | (E,4S)-4-[(2-formamidoacetyl)-methylamino]-N-hexyl-2,5-dimethylhex-2-enamide |
| SMILES | CCCCCCNC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC=O |
| InChI | InChI=1S/C18H33N3O3/c1-6-7-8-9-10-20-18(24)15(4)11-16(14(2)3)21(5)17(23)12-19-13-22/h11,13-14,16H,6-10,12H2,1-5H3,(H,19,22)(H,20,24)/b15-11+/t16-/m1/s1 |
| InChIKey | YDWYRLOAGBZFMR-RBFDBLARSA-N |
| XLogP | 1.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|