C20H28IN3 — CID 89273977
N'-[2-(2,6-dimethylanilino)ethyl]-N-(2,6-dimethylphenyl)-N'-iodoethane-1,2-diamine (PubChem CID 89273977) has the molecular formula C20H28IN3 and a molecular weight of 437.37 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylanilino)ethyl]-N-(2,6-dimethylphenyl)-N'-iodoethane-1,2-diamine.
| Compound Name | N'-[2-(2,6-dimethylanilino)ethyl]-N-(2,6-dimethylphenyl)-N'-iodoethane-1,2-diamine |
|---|---|
| PubChem CID | 89273977 |
| Molecular Formula | C20H28IN3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N'-[2-(2,6-dimethylanilino)ethyl]-N-(2,6-dimethylphenyl)-N'-iodoethane-1,2-diamine |
| SMILES | Cc1cccc(C)c1NCCN(I)CCNc1c(C)cccc1C |
| InChI | InChI=1S/C20H28IN3/c1-15-7-5-8-16(2)19(15)22-11-13-24(21)14-12-23-20-17(3)9-6-10-18(20)4/h5-10,22-23H,11-14H2,1-4H3 |
| InChIKey | PITUEQSXARXXHC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|