C11H22N3O+ — CID 89276595
[(Z,2S)-5-amino-1-oxo-4-(prop-1-en-2-ylamino)pent-4-en-2-yl]-trimethylazanium (PubChem CID 89276595) has the molecular formula C11H22N3O+ and a molecular weight of 212.32 g/mol. Its IUPAC name is [(Z,2S)-5-amino-1-oxo-4-(prop-1-en-2-ylamino)pent-4-en-2-yl]-trimethylazanium.
| Compound Name | [(Z,2S)-5-amino-1-oxo-4-(prop-1-en-2-ylamino)pent-4-en-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 89276595 |
| Molecular Formula | C11H22N3O+ |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | [(Z,2S)-5-amino-1-oxo-4-(prop-1-en-2-ylamino)pent-4-en-2-yl]-trimethylazanium |
| SMILES | C=C(C)N/C(=C\N)C[C@@H](C=O)[N+](C)(C)C |
| InChI | InChI=1S/C11H22N3O/c1-9(2)13-10(7-12)6-11(8-15)14(3,4)5/h7-8,11,13H,1,6,12H2,2-5H3/q+1/b10-7-/t11-/m0/s1 |
| InChIKey | XNDLOLBLNWJLQS-BRNRAETOSA-N |
| XLogP | 0.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|