C14H20N3O4P — CID 89277780
7-[hydroxy(phosphanyl)amino]-N-(1-methylpiperidin-4-yl)-1,3-benzodioxole-4-carboxamide (PubChem CID 89277780) has the molecular formula C14H20N3O4P and a molecular weight of 325.31 g/mol. Its IUPAC name is 7-[hydroxy(phosphanyl)amino]-N-(1-methylpiperidin-4-yl)-1,3-benzodioxole-4-carboxamide.
| Compound Name | 7-[hydroxy(phosphanyl)amino]-N-(1-methylpiperidin-4-yl)-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 89277780 |
| Molecular Formula | C14H20N3O4P |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 7-[hydroxy(phosphanyl)amino]-N-(1-methylpiperidin-4-yl)-1,3-benzodioxole-4-carboxamide |
| SMILES | CN1CCC(NC(=O)c2ccc(N(O)P)c3c2OCO3)CC1 |
| InChI | InChI=1S/C14H20N3O4P/c1-16-6-4-9(5-7-16)15-14(18)10-2-3-11(17(19)22)13-12(10)20-8-21-13/h2-3,9,19H,4-8,22H2,1H3,(H,15,18) |
| InChIKey | YTHVSXIWLCAAAN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|