C24H20N4O3 — CID 89277850
5-amino-1'-benzyl-6-iminospiro[7H-[1,3]dioxolo[4,5-g]quinoline-8,3'-indole]-2'-one (PubChem CID 89277850) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 5-amino-1'-benzyl-6-iminospiro[7H-[1,3]dioxolo[4,5-g]quinoline-8,3'-indole]-2'-one.
| Compound Name | 5-amino-1'-benzyl-6-iminospiro[7H-[1,3]dioxolo[4,5-g]quinoline-8,3'-indole]-2'-one |
|---|---|
| PubChem CID | 89277850 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-amino-1'-benzyl-6-iminospiro[7H-[1,3]dioxolo[4,5-g]quinoline-8,3'-indole]-2'-one |
| SMILES | [H]/N=C1\CC2(C(=O)N(Cc3ccccc3)c3ccccc32)c2cc3c(cc2N1N)OCO3 |
| InChI | InChI=1S/C24H20N4O3/c25-22-12-24(17-10-20-21(31-14-30-20)11-19(17)28(22)26)16-8-4-5-9-18(16)27(23(24)29)13-15-6-2-1-3-7-15/h1-11,25H,12-14,26H2/b25-22+ |
| InChIKey | WHNKKXGLCYZYDE-YYDJUVGSSA-N |
| XLogP | 3.31 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|