About (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine
(NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine (PubChem CID 89283865) has the molecular formula C12H11ClN2O
and a molecular weight of 234.69 g/mol. Its IUPAC name is (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine |
| PubChem CID | 89283865 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine |
| SMILES | Cc1cc(C)c2cc(/C=N/O)c(Cl)nc2c1 |
| InChI | InChI=1S/C12H11ClN2O/c1-7-3-8(2)10-5-9(6-14-16)12(13)15-11(10)4-7/h3-6,16H,1-2H3/b14-6+ |
| InChIKey | RFFYSEPDINKBBR-MKMNVTDBSA-N |
| XLogP | 3.31 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine?
The IUPAC name of (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine (CID 89283865) is (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine is Cc1cc(C)c2cc(/C=N/O)c(Cl)nc2c1.
What is the InChIKey of (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine?
The InChIKey is RFFYSEPDINKBBR-MKMNVTDBSA-N. The full InChI is InChI=1S/C12H11ClN2O/c1-7-3-8(2)10-5-9(6-14-16)12(13)15-11(10)4-7/h3-6,16H,1-2H3/b14-6+.
What are the key properties of (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine?
(NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine has a molecular weight of 234.69 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(2-chloro-5,7-dimethylquinolin-3-yl)methylidene]hydroxylamine is sourced from PubChem (CID 89283865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).