C17H15NO4S — CID 8928559
methyl 3-methyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 8928559) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 3-methyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-methyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8928559 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl 3-methyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2oc3ccccc3c2C)cc1C |
| InChI | InChI=1S/C17H15NO4S/c1-9-8-13(23-15(9)17(20)21-3)18-16(19)14-10(2)11-6-4-5-7-12(11)22-14/h4-8H,1-3H3,(H,18,19) |
| InChIKey | COTFPRGGNUDTOA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |