C11H18S — CID 89288995
(3E,5Z)-5-methyl-4-propan-2-ylsulfanylhepta-1,3,5-triene (PubChem CID 89288995) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is (3E,5Z)-5-methyl-4-propan-2-ylsulfanylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-5-methyl-4-propan-2-ylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89288995 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3E,5Z)-5-methyl-4-propan-2-ylsulfanylhepta-1,3,5-triene |
| SMILES | C=C/C=C(SC(C)C)\C(C)=C/C |
| InChI | InChI=1S/C11H18S/c1-6-8-11(10(5)7-2)12-9(3)4/h6-9H,1H2,2-5H3/b10-7-,11-8+ |
| InChIKey | ILQLIWNBFXXWDV-BDLVGCLISA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|