C10H23NO2 — CID 89289933
2-(4-amino-2-ethylpentyl)propane-1,3-diol (PubChem CID 89289933) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-(4-amino-2-ethylpentyl)propane-1,3-diol.
| Compound Name | 2-(4-amino-2-ethylpentyl)propane-1,3-diol |
|---|---|
| PubChem CID | 89289933 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 2-(4-amino-2-ethylpentyl)propane-1,3-diol |
| SMILES | CCC(CC(C)N)CC(CO)CO |
| InChI | InChI=1S/C10H23NO2/c1-3-9(4-8(2)11)5-10(6-12)7-13/h8-10,12-13H,3-7,11H2,1-2H3 |
| InChIKey | QGGLUIGMQORJRT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |