C15H34O4 — CID 139343033
2,4-diethylpentane-1,5-diol;hexane-1,6-diol (PubChem CID 139343033) has the molecular formula C15H34O4 and a molecular weight of 278.43 g/mol. Its IUPAC name is 2,4-diethylpentane-1,5-diol;hexane-1,6-diol.
| Compound Name | 2,4-diethylpentane-1,5-diol;hexane-1,6-diol |
|---|---|
| PubChem CID | 139343033 |
| Molecular Formula | C15H34O4 |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2,4-diethylpentane-1,5-diol;hexane-1,6-diol |
| SMILES | CCC(CO)CC(CC)CO.OCCCCCCO |
| InChI | InChI=1S/C9H20O2.C6H14O2/c1-3-8(6-10)5-9(4-2)7-11;7-5-3-1-2-4-6-8/h8-11H,3-7H2,1-2H3;7-8H,1-6H2 |
| InChIKey | DPRZNNNBPSDCEG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|