C34H39N5OS — CID 89291651
N-[2-methyl-3-[2-[4-[1-(4-methylpiperidin-1-yl)ethenyl]anilino]pyrimidin-4-yl]phenyl]-2,3,4,5,6,7-hexahydro-1-benzothiophene-2-carboxamide (PubChem CID 89291651) has the molecular formula C34H39N5OS and a molecular weight of 565.79 g/mol. Its IUPAC name is N-[2-methyl-3-[2-[4-[1-(4-methylpiperidin-1-yl)ethenyl]anilino]pyrimidin-4-yl]phenyl]-2,3,4,5,6,7-hexahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-methyl-3-[2-[4-[1-(4-methylpiperidin-1-yl)ethenyl]anilino]pyrimidin-4-yl]phenyl]-2,3,4,5,6,7-hexahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 89291651 |
| Molecular Formula | C34H39N5OS |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | N-[2-methyl-3-[2-[4-[1-(4-methylpiperidin-1-yl)ethenyl]anilino]pyrimidin-4-yl]phenyl]-2,3,4,5,6,7-hexahydro-1-benzothiophene-2-carboxamide |
| SMILES | C=C(c1ccc(Nc2nccc(-c3cccc(NC(=O)C4CC5=C(CCCC5)S4)c3C)n2)cc1)N1CCC(C)CC1 |
| InChI | InChI=1S/C34H39N5OS/c1-22-16-19-39(20-17-22)24(3)25-11-13-27(14-12-25)36-34-35-18-15-30(38-34)28-8-6-9-29(23(28)2)37-33(40)32-21-26-7-4-5-10-31(26)41-32/h6,8-9,11-15,18,22,32H,3-5,7,10,16-17,19-21H2,1-2H3,(H,37,40)(H,35,36,38) |
| InChIKey | GJEZZKDPOXSTKK-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |