C27H31N2O3PS — CID 89291726
(Z,3S)-4-imino-3-[4-[[4-methyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]-6-phosphanylhex-5-enoic acid (PubChem CID 89291726) has the molecular formula C27H31N2O3PS and a molecular weight of 494.60 g/mol. Its IUPAC name is (Z,3S)-4-imino-3-[4-[[4-methyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]-6-phosphanylhex-5-enoic acid.
| Compound Name | (Z,3S)-4-imino-3-[4-[[4-methyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]-6-phosphanylhex-5-enoic acid |
|---|---|
| PubChem CID | 89291726 |
| Molecular Formula | C27H31N2O3PS |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (Z,3S)-4-imino-3-[4-[[4-methyl-2-[4-(2-methylpropyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]-6-phosphanylhex-5-enoic acid |
| SMILES | [H]/N=C(\C=C/P)[C@@H](CC(=O)O)c1ccc(OCc2sc(-c3ccc(CC(C)C)cc3)nc2C)cc1 |
| InChI | InChI=1S/C27H31N2O3PS/c1-17(2)14-19-4-6-21(7-5-19)27-29-18(3)25(34-27)16-32-22-10-8-20(9-11-22)23(15-26(30)31)24(28)12-13-33/h4-13,17,23,28H,14-16,33H2,1-3H3,(H,30,31)/b13-12-,28-24+/t23-/m0/s1 |
| InChIKey | WKBUIKDZYXGBEB-BVXNDENASA-N |
| XLogP | 6.86 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|