C27H32N2O4S — CID 143640604
3-[4-[[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]methoxy]phenyl]-6-hydroxy-4-iminohexanoic acid (PubChem CID 143640604) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is 3-[4-[[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]methoxy]phenyl]-6-hydroxy-4-iminohexanoic acid.
| Compound Name | 3-[4-[[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]methoxy]phenyl]-6-hydroxy-4-iminohexanoic acid |
|---|---|
| PubChem CID | 143640604 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3-[4-[[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]methoxy]phenyl]-6-hydroxy-4-iminohexanoic acid |
| SMILES | [H]/N=C(\CCO)C(CC(=O)O)c1ccc(OCc2sc(-c3ccc(CCCC)cc3)nc2C)cc1 |
| InChI | InChI=1S/C27H32N2O4S/c1-3-4-5-19-6-8-21(9-7-19)27-29-18(2)25(34-27)17-33-22-12-10-20(11-13-22)23(16-26(31)32)24(28)14-15-30/h6-13,23,28,30H,3-5,14-17H2,1-2H3,(H,31,32)/b28-24+ |
| InChIKey | FJCMKFYDAXGPKB-ZZIIXHQDSA-N |
| XLogP | 6.00 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|