C20H26BN7O2 — CID 89298176
CID 89298176 (PubChem CID 89298176) has the molecular formula C20H26BN7O2 and a molecular weight of 407.29 g/mol.
| Compound Name | CID 89298176 |
|---|---|
| PubChem CID | 89298176 |
| Molecular Formula | C20H26BN7O2 |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(NC(=O)CN(C)C)cc3)cc(N[C@@H](C)CO)nc12 |
| InChI | InChI=1S/C20H26BN7O2/c1-13(12-29)24-17-8-18(28-20(26-17)16(21)10-23-28)22-9-14-4-6-15(7-5-14)25-19(30)11-27(2)3/h4-8,10,13,22,29H,9,11-12H2,1-3H3,(H,24,26)(H,25,30)/t13-/m0/s1 |
| InChIKey | HWXYZFYPZFLPBL-ZDUSSCGKSA-N |
| XLogP | 0.43 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|