C10H22Cl2N4O3 — CID 89303124
N'-[(2S)-6-amino-1-(dimethylamino)-1-oxohexan-2-yl]oxamide;dihydrochloride (PubChem CID 89303124) has the molecular formula C10H22Cl2N4O3 and a molecular weight of 317.22 g/mol. Its IUPAC name is N'-[(2S)-6-amino-1-(dimethylamino)-1-oxohexan-2-yl]oxamide;dihydrochloride.
| Compound Name | N'-[(2S)-6-amino-1-(dimethylamino)-1-oxohexan-2-yl]oxamide;dihydrochloride |
|---|---|
| PubChem CID | 89303124 |
| Molecular Formula | C10H22Cl2N4O3 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N'-[(2S)-6-amino-1-(dimethylamino)-1-oxohexan-2-yl]oxamide;dihydrochloride |
| SMILES | CN(C)C(=O)[C@H](CCCCN)NC(=O)C(N)=O.Cl.Cl |
| InChI | InChI=1S/C10H20N4O3.2ClH/c1-14(2)10(17)7(5-3-4-6-11)13-9(16)8(12)15;;/h7H,3-6,11H2,1-2H3,(H2,12,15)(H,13,16);2*1H/t7-;;/m0../s1 |
| InChIKey | LGNYJZKNABJCDH-KLXURFKVSA-N |
| XLogP | -0.98 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|