C14H23F6NO — CID 89305944
8-[bis(trifluoromethyl)amino]-3,3,5,5-tetramethyloctan-2-one (PubChem CID 89305944) has the molecular formula C14H23F6NO and a molecular weight of 335.33 g/mol. Its IUPAC name is 8-[bis(trifluoromethyl)amino]-3,3,5,5-tetramethyloctan-2-one.
| Compound Name | 8-[bis(trifluoromethyl)amino]-3,3,5,5-tetramethyloctan-2-one |
|---|---|
| PubChem CID | 89305944 |
| Molecular Formula | C14H23F6NO |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 8-[bis(trifluoromethyl)amino]-3,3,5,5-tetramethyloctan-2-one |
| SMILES | CC(=O)C(C)(C)CC(C)(C)CCCN(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H23F6NO/c1-10(22)12(4,5)9-11(2,3)7-6-8-21(13(15,16)17)14(18,19)20/h6-9H2,1-5H3 |
| InChIKey | WSQJFKPZPJEREF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|