C24H21Cl2FO3 — CID 89307648
3-[4-[(1R)-3-chloro-2-(4-chloronaphthalen-1-yl)oxycyclopentyl]-2-fluorophenyl]propanoic acid (PubChem CID 89307648) has the molecular formula C24H21Cl2FO3 and a molecular weight of 447.33 g/mol. Its IUPAC name is 3-[4-[(1R)-3-chloro-2-(4-chloronaphthalen-1-yl)oxycyclopentyl]-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[(1R)-3-chloro-2-(4-chloronaphthalen-1-yl)oxycyclopentyl]-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 89307648 |
| Molecular Formula | C24H21Cl2FO3 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 3-[4-[(1R)-3-chloro-2-(4-chloronaphthalen-1-yl)oxycyclopentyl]-2-fluorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc([C@H]2CCC(Cl)C2Oc2ccc(Cl)c3ccccc23)cc1F |
| InChI | InChI=1S/C24H21Cl2FO3/c25-19-10-11-22(18-4-2-1-3-17(18)19)30-24-16(8-9-20(24)26)15-6-5-14(21(27)13-15)7-12-23(28)29/h1-6,10-11,13,16,20,24H,7-9,12H2,(H,28,29)/t16-,20?,24?/m1/s1 |
| InChIKey | KZPRSPUZZKJXII-VIBJYCFESA-N |
| XLogP | 6.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|