C26H29FN2O3S — CID 89308033
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1-(3-fluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxamide (PubChem CID 89308033) has the molecular formula C26H29FN2O3S and a molecular weight of 468.59 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1-(3-fluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1-(3-fluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 89308033 |
| Molecular Formula | C26H29FN2O3S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1-(3-fluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxamide |
| SMILES | C=C/C=C\C(=C/C)CNC(=O)C1(c2ccccc2)CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C26H29FN2O3S/c1-3-5-10-21(4-2)20-28-25(30)26(22-11-7-6-8-12-22)15-17-29(18-16-26)33(31,32)24-14-9-13-23(27)19-24/h3-14,19H,1,15-18,20H2,2H3,(H,28,30)/b10-5-,21-4+ |
| InChIKey | HUQKSCNTNYSLNV-DQBLWAPJSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|