C20H23FN2O3S — CID 86922420
N-[2-(benzenesulfonamido)ethyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 86922420) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 86922420 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccccc1)C1(c2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C20H23FN2O3S/c21-17-8-6-7-16(15-17)20(11-4-5-12-20)19(24)22-13-14-23-27(25,26)18-9-2-1-3-10-18/h1-3,6-10,15,23H,4-5,11-14H2,(H,22,24) |
| InChIKey | HXKKRIACAVAENV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|