C10H15F2NO4 — CID 89309603
2-(2,2-difluoropropoxycarbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 89309603) has the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. Its IUPAC name is 2-(2,2-difluoropropoxycarbonylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2,2-difluoropropoxycarbonylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89309603 |
| Molecular Formula | C10H15F2NO4 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(2,2-difluoropropoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(C)(F)F |
| InChI | InChI=1S/C10H15F2NO4/c1-7(2)8(14)16-5-4-13-9(15)17-6-10(3,11)12/h1,4-6H2,2-3H3,(H,13,15) |
| InChIKey | WXOAZKJIYHJTEB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|