C8H8N2 — CID 89311939
cyclohexa-1,5-diene-1-carboximidoyl cyanide (PubChem CID 89311939) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is cyclohexa-1,5-diene-1-carboximidoyl cyanide.
| Compound Name | cyclohexa-1,5-diene-1-carboximidoyl cyanide |
|---|---|
| PubChem CID | 89311939 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | cyclohexa-1,5-diene-1-carboximidoyl cyanide |
| SMILES | [H]/N=C(\C#N)C1=CCCC=C1 |
| InChI | InChI=1S/C8H8N2/c9-6-8(10)7-4-2-1-3-5-7/h2,4-5,10H,1,3H2/b10-8+ |
| InChIKey | NSYUEFQITNAQKD-CSKARUKUSA-N |
| XLogP | 1.81 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|