C10H12N2 — CID 91137659
4-ethanimidoyl-2-ethenylhexa-2,4-dienenitrile (PubChem CID 91137659) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-ethanimidoyl-2-ethenylhexa-2,4-dienenitrile.
| Compound Name | 4-ethanimidoyl-2-ethenylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 91137659 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-ethanimidoyl-2-ethenylhexa-2,4-dienenitrile |
| SMILES | [H]/N=C(\C)C(C=C(C#N)C=C)=CC |
| InChI | InChI=1S/C10H12N2/c1-4-9(7-11)6-10(5-2)8(3)12/h4-6,12H,1H2,2-3H3/b9-6?,10-5?,12-8+ |
| InChIKey | BOXBAYNVQGIYOZ-GIRLMNPNSA-N |
| XLogP | 2.61 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|