C27H18N2O8 — CID 89312217
[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate (PubChem CID 89312217) has the molecular formula C27H18N2O8 and a molecular weight of 498.45 g/mol. Its IUPAC name is [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate.
| Compound Name | [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate |
|---|---|
| PubChem CID | 89312217 |
| Molecular Formula | C27H18N2O8 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate |
| SMILES | CC(=O)OC1c2cc(Oc3ccc([N+](=O)[O-])cc3)ccc2-c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C27H18N2O8/c1-16(30)35-27-25-14-21(36-19-6-2-17(3-7-19)28(31)32)10-12-23(25)24-13-11-22(15-26(24)27)37-20-8-4-18(5-9-20)29(33)34/h2-15,27H,1H3 |
| InChIKey | KEEMYXYOULXAQN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|