[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate

C27H18N2O8 — CID 89312217

IUPAC[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate
SMILESCC(=O)OC1c2cc(Oc3ccc([N+](=O)[O-])cc3)ccc2-c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc21
InChIInChI=1S/C27H18N2O8/c1-16(30)35-27-25-14-21(36-19-6-2-17(3-7-19)28(31)32)10-12-23(25)24-13-11-22(15-26(24)27)37-20-8-4-18(5-9-20)29(33)34/h2-15,27H,1H3
InChIKeyKEEMYXYOULXAQN-UHFFFAOYSA-N
MW498.45 g/mol
LogP6.72
Rot. Bonds7

About [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate

[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate (PubChem CID 89312217) has the molecular formula C27H18N2O8 and a molecular weight of 498.45 g/mol. Its IUPAC name is [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate.

Molecular Properties

Compound Name[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate
PubChem CID89312217
Molecular FormulaC27H18N2O8
Molecular Weight498.45 g/mol
Exact Mass498.11
IUPAC Name[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate
SMILESCC(=O)OC1c2cc(Oc3ccc([N+](=O)[O-])cc3)ccc2-c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc21
InChIInChI=1S/C27H18N2O8/c1-16(30)35-27-25-14-21(36-19-6-2-17(3-7-19)28(31)32)10-12-23(25)24-13-11-22(15-26(24)27)37-20-8-4-18(5-9-20)29(33)34/h2-15,27H,1H3
InChIKeyKEEMYXYOULXAQN-UHFFFAOYSA-N
XLogP6.72
TPSA131.04 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds7
Heavy Atoms37
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500498.45
LogP ≤ 56.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate?
The IUPAC name of [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate (CID 89312217) is [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate.
What is the SMILES notation for [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate?
The canonical SMILES for [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate is CC(=O)OC1c2cc(Oc3ccc([N+](=O)[O-])cc3)ccc2-c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc21.
What is the InChIKey of [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate?
The InChIKey is KEEMYXYOULXAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18N2O8/c1-16(30)35-27-25-14-21(36-19-6-2-17(3-7-19)28(31)32)10-12-23(25)24-13-11-22(15-26(24)27)37-20-8-4-18(5-9-20)29(33)34/h2-15,27H,1H3.
What are the key properties of [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate?
[2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate has a molecular weight of 498.45 g/mol, XLogP of 6.72, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,7-bis(4-nitrophenoxy)-9H-fluoren-9-yl] acetate is sourced from PubChem (CID 89312217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).