C20H33N3S — CID 89312440
1-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-propan-2-ylthiourea (PubChem CID 89312440) has the molecular formula C20H33N3S and a molecular weight of 347.57 g/mol. Its IUPAC name is 1-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-propan-2-ylthiourea.
| Compound Name | 1-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 89312440 |
| Molecular Formula | C20H33N3S |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-propan-2-ylthiourea |
| SMILES | CC(C)N(C(N)=S)c1ccccc1CN[C@@H](C)CC1CCCCC1 |
| InChI | InChI=1S/C20H33N3S/c1-15(2)23(20(21)24)19-12-8-7-11-18(19)14-22-16(3)13-17-9-5-4-6-10-17/h7-8,11-12,15-17,22H,4-6,9-10,13-14H2,1-3H3,(H2,21,24)/t16-/m0/s1 |
| InChIKey | MSGQCXQCABGEQZ-INIZCTEOSA-N |
| XLogP | 4.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|