C6H12NO4+ — CID 89313258
1-hydroxy-2-(methoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol (PubChem CID 89313258) has the molecular formula C6H12NO4+ and a molecular weight of 162.16 g/mol. Its IUPAC name is 1-hydroxy-2-(methoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol.
| Compound Name | 1-hydroxy-2-(methoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol |
|---|---|
| PubChem CID | 89313258 |
| Molecular Formula | C6H12NO4+ |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-hydroxy-2-(methoxymethyl)-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol |
| SMILES | COCC1C(O)C(O)C=[N+]1O |
| InChI | InChI=1S/C6H12NO4/c1-11-3-4-6(9)5(8)2-7(4)10/h2,4-6,8-10H,3H2,1H3/q+1 |
| InChIKey | DNBJYOKPIMOGPP-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|