C6H12NO4+ — CID 89313243
(2R,3S,4S)-1-hydroxy-2-[(1R)-1-hydroxyethyl]-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol (PubChem CID 89313243) has the molecular formula C6H12NO4+ and a molecular weight of 162.16 g/mol. Its IUPAC name is (2R,3S,4S)-1-hydroxy-2-[(1R)-1-hydroxyethyl]-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol.
| Compound Name | (2R,3S,4S)-1-hydroxy-2-[(1R)-1-hydroxyethyl]-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol |
|---|---|
| PubChem CID | 89313243 |
| Molecular Formula | C6H12NO4+ |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (2R,3S,4S)-1-hydroxy-2-[(1R)-1-hydroxyethyl]-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol |
| SMILES | C[C@@H](O)[C@@H]1[C@H](O)[C@@H](O)C=[N+]1O |
| InChI | InChI=1S/C6H12NO4/c1-3(8)5-6(10)4(9)2-7(5)11/h2-6,8-11H,1H3/q+1/t3-,4+,5-,6-/m1/s1 |
| InChIKey | NUDJKFYUIDGBNQ-JGWLITMVSA-N |
| XLogP | -2.06 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|