C19H12Cl2F3N5 — CID 89314607
5-[8-[(2,6-dichlorophenyl)methyl]-7H-purin-6-yl]-2-(trifluoromethyl)aniline (PubChem CID 89314607) has the molecular formula C19H12Cl2F3N5 and a molecular weight of 438.24 g/mol. Its IUPAC name is 5-[8-[(2,6-dichlorophenyl)methyl]-7H-purin-6-yl]-2-(trifluoromethyl)aniline.
| Compound Name | 5-[8-[(2,6-dichlorophenyl)methyl]-7H-purin-6-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 89314607 |
| Molecular Formula | C19H12Cl2F3N5 |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 5-[8-[(2,6-dichlorophenyl)methyl]-7H-purin-6-yl]-2-(trifluoromethyl)aniline |
| SMILES | Nc1cc(-c2ncnc3nc(Cc4c(Cl)cccc4Cl)[nH]c23)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H12Cl2F3N5/c20-12-2-1-3-13(21)10(12)7-15-28-17-16(26-8-27-18(17)29-15)9-4-5-11(14(25)6-9)19(22,23)24/h1-6,8H,7,25H2,(H,26,27,28,29) |
| InChIKey | OBRUKBYVTLTMBH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|