C16H19NO2 — CID 89316638
methyl 2-[3-[(1E,3Z)-1-amino-3-methylhexa-1,3,5-trien-2-yl]phenyl]acetate (PubChem CID 89316638) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 2-[3-[(1E,3Z)-1-amino-3-methylhexa-1,3,5-trien-2-yl]phenyl]acetate.
| Compound Name | methyl 2-[3-[(1E,3Z)-1-amino-3-methylhexa-1,3,5-trien-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 89316638 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl 2-[3-[(1E,3Z)-1-amino-3-methylhexa-1,3,5-trien-2-yl]phenyl]acetate |
| SMILES | C=C/C=C(C)\C(=C/N)c1cccc(CC(=O)OC)c1 |
| InChI | InChI=1S/C16H19NO2/c1-4-6-12(2)15(11-17)14-8-5-7-13(9-14)10-16(18)19-3/h4-9,11H,1,10,17H2,2-3H3/b12-6-,15-11+ |
| InChIKey | FCHICSIYYMHIIR-DQNIYQCBSA-N |
| XLogP | 2.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|