C17H38N2O6 — CID 89316703
3-amino-3-ethyl-1-[2-[2-[2-[2-hydroxy-3-(methylamino)propoxy]ethoxy]ethoxy]ethoxy]pentan-2-ol (PubChem CID 89316703) has the molecular formula C17H38N2O6 and a molecular weight of 366.50 g/mol. Its IUPAC name is 3-amino-3-ethyl-1-[2-[2-[2-[2-hydroxy-3-(methylamino)propoxy]ethoxy]ethoxy]ethoxy]pentan-2-ol.
| Compound Name | 3-amino-3-ethyl-1-[2-[2-[2-[2-hydroxy-3-(methylamino)propoxy]ethoxy]ethoxy]ethoxy]pentan-2-ol |
|---|---|
| PubChem CID | 89316703 |
| Molecular Formula | C17H38N2O6 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 3-amino-3-ethyl-1-[2-[2-[2-[2-hydroxy-3-(methylamino)propoxy]ethoxy]ethoxy]ethoxy]pentan-2-ol |
| SMILES | CCC(N)(CC)C(O)COCCOCCOCCOCC(O)CNC |
| InChI | InChI=1S/C17H38N2O6/c1-4-17(18,5-2)16(21)14-25-11-9-23-7-6-22-8-10-24-13-15(20)12-19-3/h15-16,19-21H,4-14,18H2,1-3H3 |
| InChIKey | DBBGIKCANQMOIJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|